C26H6Cl8N2O5 — CID 139597080
4,5,6,7-tetrachloro-2-[2-(4,5,6,7-tetrachloro-2-hydroxy-1,3-dioxoinden-2-yl)quinolin-8-yl]isoindole-1,3-dione (PubChem CID 139597080) has the molecular formula C26H6Cl8N2O5 and a molecular weight of 709.97 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[2-(4,5,6,7-tetrachloro-2-hydroxy-1,3-dioxoinden-2-yl)quinolin-8-yl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[2-(4,5,6,7-tetrachloro-2-hydroxy-1,3-dioxoinden-2-yl)quinolin-8-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139597080 |
| Molecular Formula | C26H6Cl8N2O5 |
| Molecular Weight | 709.97 g/mol |
| Exact Mass | 705.78 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[2-(4,5,6,7-tetrachloro-2-hydroxy-1,3-dioxoinden-2-yl)quinolin-8-yl]isoindole-1,3-dione |
| SMILES | O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)N1c1cccc2ccc(C3(O)C(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c4C3=O)nc12 |
| InChI | InChI=1S/C26H6Cl8N2O5/c27-13-9-10(14(28)18(32)17(13)31)23(38)26(41,22(9)37)8-5-4-6-2-1-3-7(21(6)35-8)36-24(39)11-12(25(36)40)16(30)20(34)19(33)15(11)29/h1-5,41H |
| InChIKey | SHWMBWQYMASYPI-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.97 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|