C18H38S5 — CID 139597093
2,2,3,4-tetramethyl-4-(2,3,4,4-tetramethylpentan-2-ylpentasulfanyl)pentane (PubChem CID 139597093) has the molecular formula C18H38S5 and a molecular weight of 414.84 g/mol. Its IUPAC name is 2,2,3,4-tetramethyl-4-(2,3,4,4-tetramethylpentan-2-ylpentasulfanyl)pentane.
| Compound Name | 2,2,3,4-tetramethyl-4-(2,3,4,4-tetramethylpentan-2-ylpentasulfanyl)pentane |
|---|---|
| PubChem CID | 139597093 |
| Molecular Formula | C18H38S5 |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2,2,3,4-tetramethyl-4-(2,3,4,4-tetramethylpentan-2-ylpentasulfanyl)pentane |
| SMILES | CC(C(C)(C)C)C(C)(C)SSSSSC(C)(C)C(C)C(C)(C)C |
| InChI | InChI=1S/C18H38S5/c1-13(15(3,4)5)17(9,10)19-21-23-22-20-18(11,12)14(2)16(6,7)8/h13-14H,1-12H3 |
| InChIKey | SJERFRLYPYEROR-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|