C15H26F9N2O8S3+ — CID 139597108
dimethyl-[3-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(3-sulfopropyl)amino]propyl]-(3-sulfopropyl)azanium (PubChem CID 139597108) has the molecular formula C15H26F9N2O8S3+ and a molecular weight of 629.56 g/mol. Its IUPAC name is dimethyl-[3-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(3-sulfopropyl)amino]propyl]-(3-sulfopropyl)azanium.
| Compound Name | dimethyl-[3-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(3-sulfopropyl)amino]propyl]-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 139597108 |
| Molecular Formula | C15H26F9N2O8S3+ |
| Molecular Weight | 629.56 g/mol |
| Exact Mass | 629.07 |
| IUPAC Name | dimethyl-[3-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(3-sulfopropyl)amino]propyl]-(3-sulfopropyl)azanium |
| SMILES | C[N+](C)(CCCN(CCCS(=O)(=O)O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCS(=O)(=O)O |
| InChI | InChI=1S/C15H25F9N2O8S3/c1-26(2,9-5-11-36(30,31)32)8-3-6-25(7-4-10-35(27,28)29)37(33,34)15(23,24)13(18,19)12(16,17)14(20,21)22/h3-11H2,1-2H3,(H-,27,28,29,30,31,32)/p+1 |
| InChIKey | SLCJWMLFYWRTEQ-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 146.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.56 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|