C8H5F13O4S — CID 139597220
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-hydroxyoctane-1-sulfonic acid (PubChem CID 139597220) has the molecular formula C8H5F13O4S and a molecular weight of 444.17 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-hydroxyoctane-1-sulfonic acid.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-hydroxyoctane-1-sulfonic acid |
|---|---|
| PubChem CID | 139597220 |
| Molecular Formula | C8H5F13O4S |
| Molecular Weight | 444.17 g/mol |
| Exact Mass | 443.97 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-hydroxyoctane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F13O4S/c9-3(10,1-2(22)26(23,24)25)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h2,22H,1H2,(H,23,24,25) |
| InChIKey | TWHCHVHSCCYMJT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.17 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|