C19H33N3O3 — CID 139597411
(13S,17S)-5-acetyl-17-[(1S)-1-hydroxypropyl]-1,5,10-triazabicyclo[11.4.0]heptadec-14-en-11-one (PubChem CID 139597411) has the molecular formula C19H33N3O3 and a molecular weight of 351.49 g/mol. Its IUPAC name is (13S,17S)-5-acetyl-17-[(1S)-1-hydroxypropyl]-1,5,10-triazabicyclo[11.4.0]heptadec-14-en-11-one.
| Compound Name | (13S,17S)-5-acetyl-17-[(1S)-1-hydroxypropyl]-1,5,10-triazabicyclo[11.4.0]heptadec-14-en-11-one |
|---|---|
| PubChem CID | 139597411 |
| Molecular Formula | C19H33N3O3 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | (13S,17S)-5-acetyl-17-[(1S)-1-hydroxypropyl]-1,5,10-triazabicyclo[11.4.0]heptadec-14-en-11-one |
| SMILES | CC[C@H](O)[C@@H]1CC=C[C@@H]2CC(=O)NCCCCN(C(C)=O)CCCN21 |
| InChI | InChI=1S/C19H33N3O3/c1-3-18(24)17-9-6-8-16-14-19(25)20-10-4-5-11-21(15(2)23)12-7-13-22(16)17/h6,8,16-18,24H,3-5,7,9-14H2,1-2H3,(H,20,25)/t16-,17+,18+/m1/s1 |
| InChIKey | UZWUTVIUCRMZKJ-SQNIBIBYSA-N |
| XLogP | 1.30 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|