C10H5F17O4S — CID 139597522
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-hydroxydecane-1-sulfonic acid (PubChem CID 139597522) has the molecular formula C10H5F17O4S and a molecular weight of 544.18 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-hydroxydecane-1-sulfonic acid.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-hydroxydecane-1-sulfonic acid |
|---|---|
| PubChem CID | 139597522 |
| Molecular Formula | C10H5F17O4S |
| Molecular Weight | 544.18 g/mol |
| Exact Mass | 543.96 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-hydroxydecane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H5F17O4S/c11-3(12,1-2(28)32(29,30)31)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27/h2,28H,1H2,(H,29,30,31) |
| InChIKey | VRJWTMNIGCNXFO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.18 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|