C16H26O5 — CID 139597700
2-[(3R,6R,8S,10R)-2-[(2R)-butan-2-yl]-10-hydroxy-3-methyl-1,7-dioxaspiro[5.5]undec-4-en-8-yl]acetic acid (PubChem CID 139597700) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2-[(3R,6R,8S,10R)-2-[(2R)-butan-2-yl]-10-hydroxy-3-methyl-1,7-dioxaspiro[5.5]undec-4-en-8-yl]acetic acid.
| Compound Name | 2-[(3R,6R,8S,10R)-2-[(2R)-butan-2-yl]-10-hydroxy-3-methyl-1,7-dioxaspiro[5.5]undec-4-en-8-yl]acetic acid |
|---|---|
| PubChem CID | 139597700 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 2-[(3R,6R,8S,10R)-2-[(2R)-butan-2-yl]-10-hydroxy-3-methyl-1,7-dioxaspiro[5.5]undec-4-en-8-yl]acetic acid |
| SMILES | CC[C@@H](C)C1O[C@@]2(C=C[C@H]1C)C[C@H](O)C[C@@H](CC(=O)O)O2 |
| InChI | InChI=1S/C16H26O5/c1-4-10(2)15-11(3)5-6-16(21-15)9-12(17)7-13(20-16)8-14(18)19/h5-6,10-13,15,17H,4,7-9H2,1-3H3,(H,18,19)/t10-,11-,12-,13+,15?,16+/m1/s1 |
| InChIKey | WPUOTAFLLXNDCT-DBRWDGDCSA-N |
| XLogP | 2.33 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|