C17H26F13N2O8S3+ — CID 139597837
dimethyl-(3-sulfopropyl)-[3-[3-sulfopropyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]propyl]azanium (PubChem CID 139597837) has the molecular formula C17H26F13N2O8S3+ and a molecular weight of 729.58 g/mol. Its IUPAC name is dimethyl-(3-sulfopropyl)-[3-[3-sulfopropyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]propyl]azanium.
| Compound Name | dimethyl-(3-sulfopropyl)-[3-[3-sulfopropyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 139597837 |
| Molecular Formula | C17H26F13N2O8S3+ |
| Molecular Weight | 729.58 g/mol |
| Exact Mass | 729.06 |
| IUPAC Name | dimethyl-(3-sulfopropyl)-[3-[3-sulfopropyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]propyl]azanium |
| SMILES | C[N+](C)(CCCN(CCCS(=O)(=O)O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCS(=O)(=O)O |
| InChI | InChI=1S/C17H25F13N2O8S3/c1-32(2,9-5-11-42(36,37)38)8-3-6-31(7-4-10-41(33,34)35)43(39,40)17(29,30)15(24,25)13(20,21)12(18,19)14(22,23)16(26,27)28/h3-11H2,1-2H3,(H-,33,34,35,36,37,38)/p+1 |
| InChIKey | XJWXHAVPVAKYGX-UHFFFAOYSA-O |
| XLogP | 3.34 |
| TPSA | 146.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|