C11H20F7N2O5S2+ — CID 139598028
3-(1,1,2,2,3,3,3-heptafluoropropylsulfonylamino)propyl-dimethyl-(3-sulfopropyl)azanium (PubChem CID 139598028) has the molecular formula C11H20F7N2O5S2+ and a molecular weight of 457.41 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,3-heptafluoropropylsulfonylamino)propyl-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | 3-(1,1,2,2,3,3,3-heptafluoropropylsulfonylamino)propyl-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 139598028 |
| Molecular Formula | C11H20F7N2O5S2+ |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 3-(1,1,2,2,3,3,3-heptafluoropropylsulfonylamino)propyl-dimethyl-(3-sulfopropyl)azanium |
| SMILES | C[N+](C)(CCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F)CCCS(=O)(=O)O |
| InChI | InChI=1S/C11H19F7N2O5S2/c1-20(2,7-4-8-26(21,22)23)6-3-5-19-27(24,25)11(17,18)9(12,13)10(14,15)16/h19H,3-8H2,1-2H3/p+1 |
| InChIKey | YKNXTHVJGQBLAC-UHFFFAOYSA-O |
| XLogP | 1.44 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|