About 2-tert-butylimino-5-phenyl-1,3,5-thiadiazinan-4-one
2-tert-butylimino-5-phenyl-1,3,5-thiadiazinan-4-one (PubChem CID 139598142) has the molecular formula C13H17N3OS
and a molecular weight of 263.37 g/mol. Its IUPAC name is 2-tert-butylimino-5-phenyl-1,3,5-thiadiazinan-4-one.
Molecular Properties
| Compound Name | 2-tert-butylimino-5-phenyl-1,3,5-thiadiazinan-4-one |
| PubChem CID | 139598142 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-tert-butylimino-5-phenyl-1,3,5-thiadiazinan-4-one |
| SMILES | CC(C)(C)/N=C1/NC(=O)N(c2ccccc2)CS1 |
| InChI | InChI=1S/C13H17N3OS/c1-13(2,3)15-11-14-12(17)16(9-18-11)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3,(H,14,15,17) |
| InChIKey | ZAMPABOHKGLFTC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butylimino-5-phenyl-1,3,5-thiadiazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylimino-5-phenyl-1,3,5-thiadiazinan-4-one?
The IUPAC name of 2-tert-butylimino-5-phenyl-1,3,5-thiadiazinan-4-one (CID 139598142) is 2-tert-butylimino-5-phenyl-1,3,5-thiadiazinan-4-one.
What is the SMILES notation for 2-tert-butylimino-5-phenyl-1,3,5-thiadiazinan-4-one?
The canonical SMILES for 2-tert-butylimino-5-phenyl-1,3,5-thiadiazinan-4-one is CC(C)(C)/N=C1/NC(=O)N(c2ccccc2)CS1.
What is the InChIKey of 2-tert-butylimino-5-phenyl-1,3,5-thiadiazinan-4-one?
The InChIKey is ZAMPABOHKGLFTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3OS/c1-13(2,3)15-11-14-12(17)16(9-18-11)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3,(H,14,15,17).
What are the key properties of 2-tert-butylimino-5-phenyl-1,3,5-thiadiazinan-4-one?
2-tert-butylimino-5-phenyl-1,3,5-thiadiazinan-4-one has a molecular weight of 263.37 g/mol, XLogP of 3.06, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylimino-5-phenyl-1,3,5-thiadiazinan-4-one is sourced from PubChem (CID 139598142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).