C9H5F15O4S — CID 139598315
3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoro-1-hydroxynonane-1-sulfonic acid (PubChem CID 139598315) has the molecular formula C9H5F15O4S and a molecular weight of 494.17 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoro-1-hydroxynonane-1-sulfonic acid.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoro-1-hydroxynonane-1-sulfonic acid |
|---|---|
| PubChem CID | 139598315 |
| Molecular Formula | C9H5F15O4S |
| Molecular Weight | 494.17 g/mol |
| Exact Mass | 493.97 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoro-1-hydroxynonane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H5F15O4S/c10-3(11,1-2(25)29(26,27)28)4(12,13)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)24/h2,25H,1H2,(H,26,27,28) |
| InChIKey | ZZQKNCHBPCJOSC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.17 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|