About 5-butyl-5-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethylfuran-2-one
5-butyl-5-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethylfuran-2-one (PubChem CID 139598331) has the molecular formula C17H24O5
and a molecular weight of 308.37 g/mol. Its IUPAC name is 5-butyl-5-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethylfuran-2-one.
Molecular Properties
| Compound Name | 5-butyl-5-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethylfuran-2-one |
| PubChem CID | 139598331 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 5-butyl-5-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethylfuran-2-one |
| SMILES | CCCCC1([C@]2(C)COC(=O)/C2=C(/C)O)OC(=O)C(C)=C1C |
| InChI | InChI=1S/C17H24O5/c1-6-7-8-17(11(3)10(2)14(19)22-17)16(5)9-21-15(20)13(16)12(4)18/h18H,6-9H2,1-5H3/b13-12+/t16-,17?/m1/s1 |
| InChIKey | SVPRXINNTADNTM-OVGKXFBCSA-N |
| XLogP | 3.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-butyl-5-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethylfuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-5-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethylfuran-2-one?
The IUPAC name of 5-butyl-5-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethylfuran-2-one (CID 139598331) is 5-butyl-5-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethylfuran-2-one.
What is the SMILES notation for 5-butyl-5-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethylfuran-2-one?
The canonical SMILES for 5-butyl-5-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethylfuran-2-one is CCCCC1([C@]2(C)COC(=O)/C2=C(/C)O)OC(=O)C(C)=C1C.
What is the InChIKey of 5-butyl-5-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethylfuran-2-one?
The InChIKey is SVPRXINNTADNTM-OVGKXFBCSA-N. The full InChI is InChI=1S/C17H24O5/c1-6-7-8-17(11(3)10(2)14(19)22-17)16(5)9-21-15(20)13(16)12(4)18/h18H,6-9H2,1-5H3/b13-12+/t16-,17?/m1/s1.
What are the key properties of 5-butyl-5-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethylfuran-2-one?
5-butyl-5-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethylfuran-2-one has a molecular weight of 308.37 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-5-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethylfuran-2-one is sourced from PubChem (CID 139598331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).