C21H26N2O2 — CID 139598788
(3aS,7aS)-2-[(2-propan-2-yloxynaphthalen-1-yl)methyl]-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one (PubChem CID 139598788) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (3aS,7aS)-2-[(2-propan-2-yloxynaphthalen-1-yl)methyl]-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one.
| Compound Name | (3aS,7aS)-2-[(2-propan-2-yloxynaphthalen-1-yl)methyl]-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one |
|---|---|
| PubChem CID | 139598788 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (3aS,7aS)-2-[(2-propan-2-yloxynaphthalen-1-yl)methyl]-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one |
| SMILES | CC(C)Oc1ccc2ccccc2c1CN1C[C@H]2CC(=O)NC[C@H]2C1 |
| InChI | InChI=1S/C21H26N2O2/c1-14(2)25-20-8-7-15-5-3-4-6-18(15)19(20)13-23-11-16-9-21(24)22-10-17(16)12-23/h3-8,14,16-17H,9-13H2,1-2H3,(H,22,24)/t16-,17+/m1/s1 |
| InChIKey | CQCZODGJUWCASR-SJORKVTESA-N |
| XLogP | 3.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |