C15H18F2N2O — CID 139599039
(3aS,7aS)-2-[(2,6-difluoro-3-methylphenyl)methyl]-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one (PubChem CID 139599039) has the molecular formula C15H18F2N2O and a molecular weight of 280.32 g/mol. Its IUPAC name is (3aS,7aS)-2-[(2,6-difluoro-3-methylphenyl)methyl]-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one.
| Compound Name | (3aS,7aS)-2-[(2,6-difluoro-3-methylphenyl)methyl]-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one |
|---|---|
| PubChem CID | 139599039 |
| Molecular Formula | C15H18F2N2O |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (3aS,7aS)-2-[(2,6-difluoro-3-methylphenyl)methyl]-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one |
| SMILES | Cc1ccc(F)c(CN2C[C@H]3CC(=O)NC[C@H]3C2)c1F |
| InChI | InChI=1S/C15H18F2N2O/c1-9-2-3-13(16)12(15(9)17)8-19-6-10-4-14(20)18-5-11(10)7-19/h2-3,10-11H,4-8H2,1H3,(H,18,20)/t10-,11+/m1/s1 |
| InChIKey | HGNFCDVYRNPBPN-MNOVXSKESA-N |
| XLogP | 1.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |