About 4-[1-[2-(1,4-dioxan-2-yl)ethyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one
4-[1-[2-(1,4-dioxan-2-yl)ethyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one (PubChem CID 139599068) has the molecular formula C16H25N3O3
and a molecular weight of 307.39 g/mol. Its IUPAC name is 4-[1-[2-(1,4-dioxan-2-yl)ethyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[1-[2-(1,4-dioxan-2-yl)ethyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one |
| PubChem CID | 139599068 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 4-[1-[2-(1,4-dioxan-2-yl)ethyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(C2CCN(CCC3COCCO3)CC2)cc(=O)[nH]1 |
| InChI | InChI=1S/C16H25N3O3/c1-12-17-15(10-16(20)18-12)13-2-5-19(6-3-13)7-4-14-11-21-8-9-22-14/h10,13-14H,2-9,11H2,1H3,(H,17,18,20) |
| InChIKey | WJHBUMKBWLYRLY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-[2-(1,4-dioxan-2-yl)ethyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[2-(1,4-dioxan-2-yl)ethyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one?
The IUPAC name of 4-[1-[2-(1,4-dioxan-2-yl)ethyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one (CID 139599068) is 4-[1-[2-(1,4-dioxan-2-yl)ethyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[1-[2-(1,4-dioxan-2-yl)ethyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one?
The canonical SMILES for 4-[1-[2-(1,4-dioxan-2-yl)ethyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one is Cc1nc(C2CCN(CCC3COCCO3)CC2)cc(=O)[nH]1.
What is the InChIKey of 4-[1-[2-(1,4-dioxan-2-yl)ethyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one?
The InChIKey is WJHBUMKBWLYRLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O3/c1-12-17-15(10-16(20)18-12)13-2-5-19(6-3-13)7-4-14-11-21-8-9-22-14/h10,13-14H,2-9,11H2,1H3,(H,17,18,20).
What are the key properties of 4-[1-[2-(1,4-dioxan-2-yl)ethyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one?
4-[1-[2-(1,4-dioxan-2-yl)ethyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one has a molecular weight of 307.39 g/mol, XLogP of 1.06, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[2-(1,4-dioxan-2-yl)ethyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one is sourced from PubChem (CID 139599068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).