C9H14N2O2 — CID 139599729
(3R,4S)-4-[(3-methyl-1,2-oxazol-5-yl)methyl]oxolan-3-amine (PubChem CID 139599729) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is (3R,4S)-4-[(3-methyl-1,2-oxazol-5-yl)methyl]oxolan-3-amine.
| Compound Name | (3R,4S)-4-[(3-methyl-1,2-oxazol-5-yl)methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 139599729 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (3R,4S)-4-[(3-methyl-1,2-oxazol-5-yl)methyl]oxolan-3-amine |
| SMILES | Cc1cc(C[C@@H]2COC[C@@H]2N)on1 |
| InChI | InChI=1S/C9H14N2O2/c1-6-2-8(13-11-6)3-7-4-12-5-9(7)10/h2,7,9H,3-5,10H2,1H3/t7-,9+/m1/s1 |
| InChIKey | ZTOGKNKUDLFMJE-APPZFPTMSA-N |
| XLogP | 0.50 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |