About 4-(1,3,2-dioxaborolan-2-yl)-1H-pyrazole
4-(1,3,2-dioxaborolan-2-yl)-1H-pyrazole (PubChem CID 139599802) has the molecular formula C5H7BN2O2
and a molecular weight of 137.94 g/mol. Its IUPAC name is 4-(1,3,2-dioxaborolan-2-yl)-1H-pyrazole.
Molecular Properties
| Compound Name | 4-(1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
| PubChem CID | 139599802 |
| Molecular Formula | C5H7BN2O2 |
| Molecular Weight | 137.94 g/mol |
| Exact Mass | 138.06 |
| IUPAC Name | 4-(1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
| SMILES | c1n[nH]cc1B1OCCO1 |
| InChI | InChI=1S/C5H7BN2O2/c1-2-10-6(9-1)5-3-7-8-4-5/h3-4H,1-2H2,(H,7,8) |
| InChIKey | BMQOPKIAPDKYOJ-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.94 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3,2-dioxaborolan-2-yl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3,2-dioxaborolan-2-yl)-1H-pyrazole?
The IUPAC name of 4-(1,3,2-dioxaborolan-2-yl)-1H-pyrazole (CID 139599802) is 4-(1,3,2-dioxaborolan-2-yl)-1H-pyrazole.
What is the SMILES notation for 4-(1,3,2-dioxaborolan-2-yl)-1H-pyrazole?
The canonical SMILES for 4-(1,3,2-dioxaborolan-2-yl)-1H-pyrazole is c1n[nH]cc1B1OCCO1.
What is the InChIKey of 4-(1,3,2-dioxaborolan-2-yl)-1H-pyrazole?
The InChIKey is BMQOPKIAPDKYOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7BN2O2/c1-2-10-6(9-1)5-3-7-8-4-5/h3-4H,1-2H2,(H,7,8).
What are the key properties of 4-(1,3,2-dioxaborolan-2-yl)-1H-pyrazole?
4-(1,3,2-dioxaborolan-2-yl)-1H-pyrazole has a molecular weight of 137.94 g/mol, XLogP of -0.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3,2-dioxaborolan-2-yl)-1H-pyrazole is sourced from PubChem (CID 139599802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).