About (3S,6S)-3-butyl-6-methylpiperazine-2,5-dione
(3S,6S)-3-butyl-6-methylpiperazine-2,5-dione (PubChem CID 139599839) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is (3S,6S)-3-butyl-6-methylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | (3S,6S)-3-butyl-6-methylpiperazine-2,5-dione |
| PubChem CID | 139599839 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | (3S,6S)-3-butyl-6-methylpiperazine-2,5-dione |
| SMILES | CCCC[C@@H]1NC(=O)[C@H](C)NC1=O |
| InChI | InChI=1S/C9H16N2O2/c1-3-4-5-7-9(13)10-6(2)8(12)11-7/h6-7H,3-5H2,1-2H3,(H,10,13)(H,11,12)/t6-,7-/m0/s1 |
| InChIKey | SHYWDFCZXCPLHM-BQBZGAKWSA-N |
| XLogP | 0.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,6S)-3-butyl-6-methylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,6S)-3-butyl-6-methylpiperazine-2,5-dione?
The IUPAC name of (3S,6S)-3-butyl-6-methylpiperazine-2,5-dione (CID 139599839) is (3S,6S)-3-butyl-6-methylpiperazine-2,5-dione.
What is the SMILES notation for (3S,6S)-3-butyl-6-methylpiperazine-2,5-dione?
The canonical SMILES for (3S,6S)-3-butyl-6-methylpiperazine-2,5-dione is CCCC[C@@H]1NC(=O)[C@H](C)NC1=O.
What is the InChIKey of (3S,6S)-3-butyl-6-methylpiperazine-2,5-dione?
The InChIKey is SHYWDFCZXCPLHM-BQBZGAKWSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-3-4-5-7-9(13)10-6(2)8(12)11-7/h6-7H,3-5H2,1-2H3,(H,10,13)(H,11,12)/t6-,7-/m0/s1.
What are the key properties of (3S,6S)-3-butyl-6-methylpiperazine-2,5-dione?
(3S,6S)-3-butyl-6-methylpiperazine-2,5-dione has a molecular weight of 184.24 g/mol, XLogP of 0.18, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,6S)-3-butyl-6-methylpiperazine-2,5-dione is sourced from PubChem (CID 139599839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).