C15H20O2 — CID 139599901
methyl (2E,4E,8Z,10E,12E)-tetradeca-2,4,8,10,12-pentaenoate (PubChem CID 139599901) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is methyl (2E,4E,8Z,10E,12E)-tetradeca-2,4,8,10,12-pentaenoate.
| Compound Name | methyl (2E,4E,8Z,10E,12E)-tetradeca-2,4,8,10,12-pentaenoate |
|---|---|
| PubChem CID | 139599901 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | methyl (2E,4E,8Z,10E,12E)-tetradeca-2,4,8,10,12-pentaenoate |
| SMILES | C/C=C/C=C/C=C\CC/C=C/C=C/C(=O)OC |
| InChI | InChI=1S/C15H20O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2/h3-8,11-14H,9-10H2,1-2H3/b4-3+,6-5+,8-7-,12-11+,14-13+ |
| InChIKey | RFGACKBRMQVEFR-OSYQQYLUSA-N |
| XLogP | 3.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|