C14H18F4O4Si2 — CID 139600067
bis(trimethylsilyl) 3,4,5,6-tetrafluorobenzene-1,2-dicarboxylate (PubChem CID 139600067) has the molecular formula C14H18F4O4Si2 and a molecular weight of 382.46 g/mol. Its IUPAC name is bis(trimethylsilyl) 3,4,5,6-tetrafluorobenzene-1,2-dicarboxylate.
| Compound Name | bis(trimethylsilyl) 3,4,5,6-tetrafluorobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139600067 |
| Molecular Formula | C14H18F4O4Si2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | bis(trimethylsilyl) 3,4,5,6-tetrafluorobenzene-1,2-dicarboxylate |
| SMILES | C[Si](C)(C)OC(=O)c1c(F)c(F)c(F)c(F)c1C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C14H18F4O4Si2/c1-23(2,3)21-13(19)7-8(14(20)22-24(4,5)6)10(16)12(18)11(17)9(7)15/h1-6H3 |
| InChIKey | ZOQNBNQNQNPGFV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|