C27H41FO5 — CID 139600982
methyl 5-[(3aS,5R,6S,6aS)-6-[(E)-4-fluoro-3-oxooct-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate (PubChem CID 139600982) has the molecular formula C27H41FO5 and a molecular weight of 464.62 g/mol. Its IUPAC name is methyl 5-[(3aS,5R,6S,6aS)-6-[(E)-4-fluoro-3-oxooct-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate.
| Compound Name | methyl 5-[(3aS,5R,6S,6aS)-6-[(E)-4-fluoro-3-oxooct-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate |
|---|---|
| PubChem CID | 139600982 |
| Molecular Formula | C27H41FO5 |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | methyl 5-[(3aS,5R,6S,6aS)-6-[(E)-4-fluoro-3-oxooct-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate |
| SMILES | CCCCC(F)C(=O)/C=C/[C@H]1[C@H]2CC(CCCCC(=O)OC)=C[C@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C27H41FO5/c1-3-4-10-23(28)24(29)14-13-21-22-17-19(9-5-6-11-26(30)31-2)16-20(22)18-25(21)33-27-12-7-8-15-32-27/h13-14,16,20-23,25,27H,3-12,15,17-18H2,1-2H3/b14-13+/t20-,21-,22-,23?,25+,27?/m0/s1 |
| InChIKey | OJORKOVBENLLSH-ZXHKVERJSA-N |
| XLogP | 5.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|