About 2,2-bis(2-chloroethylsulfonylmethyl)-1,3-dioxolane
2,2-bis(2-chloroethylsulfonylmethyl)-1,3-dioxolane (PubChem CID 139601553) has the molecular formula C9H16Cl2O6S2
and a molecular weight of 355.26 g/mol. Its IUPAC name is 2,2-bis(2-chloroethylsulfonylmethyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | 2,2-bis(2-chloroethylsulfonylmethyl)-1,3-dioxolane |
| PubChem CID | 139601553 |
| Molecular Formula | C9H16Cl2O6S2 |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 2,2-bis(2-chloroethylsulfonylmethyl)-1,3-dioxolane |
| SMILES | O=S(=O)(CCCl)CC1(CS(=O)(=O)CCCl)OCCO1 |
| InChI | InChI=1S/C9H16Cl2O6S2/c10-1-5-18(12,13)7-9(16-3-4-17-9)8-19(14,15)6-2-11/h1-8H2 |
| InChIKey | BUWOKKDGNYNCHL-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(2-chloroethylsulfonylmethyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(2-chloroethylsulfonylmethyl)-1,3-dioxolane?
The IUPAC name of 2,2-bis(2-chloroethylsulfonylmethyl)-1,3-dioxolane (CID 139601553) is 2,2-bis(2-chloroethylsulfonylmethyl)-1,3-dioxolane.
What is the SMILES notation for 2,2-bis(2-chloroethylsulfonylmethyl)-1,3-dioxolane?
The canonical SMILES for 2,2-bis(2-chloroethylsulfonylmethyl)-1,3-dioxolane is O=S(=O)(CCCl)CC1(CS(=O)(=O)CCCl)OCCO1.
What is the InChIKey of 2,2-bis(2-chloroethylsulfonylmethyl)-1,3-dioxolane?
The InChIKey is BUWOKKDGNYNCHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16Cl2O6S2/c10-1-5-18(12,13)7-9(16-3-4-17-9)8-19(14,15)6-2-11/h1-8H2.
What are the key properties of 2,2-bis(2-chloroethylsulfonylmethyl)-1,3-dioxolane?
2,2-bis(2-chloroethylsulfonylmethyl)-1,3-dioxolane has a molecular weight of 355.26 g/mol, XLogP of 0.04, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(2-chloroethylsulfonylmethyl)-1,3-dioxolane is sourced from PubChem (CID 139601553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).