About 1-[2-[2-(2,4-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,4-dimethylpiperidine
1-[2-[2-(2,4-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,4-dimethylpiperidine (PubChem CID 139602227) has the molecular formula C18H36N2O
and a molecular weight of 296.50 g/mol. Its IUPAC name is 1-[2-[2-(2,4-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,4-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-[2-[2-(2,4-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,4-dimethylpiperidine |
| PubChem CID | 139602227 |
| Molecular Formula | C18H36N2O |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.28 |
| IUPAC Name | 1-[2-[2-(2,4-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,4-dimethylpiperidine |
| SMILES | CC1CCN(CCOCCN2CCC(C)CC2C)C(C)C1 |
| InChI | InChI=1S/C18H36N2O/c1-15-5-7-19(17(3)13-15)9-11-21-12-10-20-8-6-16(2)14-18(20)4/h15-18H,5-14H2,1-4H3 |
| InChIKey | FYOLIWHOVARXHJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[2-(2,4-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,4-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[2-(2,4-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,4-dimethylpiperidine?
The IUPAC name of 1-[2-[2-(2,4-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,4-dimethylpiperidine (CID 139602227) is 1-[2-[2-(2,4-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,4-dimethylpiperidine.
What is the SMILES notation for 1-[2-[2-(2,4-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,4-dimethylpiperidine?
The canonical SMILES for 1-[2-[2-(2,4-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,4-dimethylpiperidine is CC1CCN(CCOCCN2CCC(C)CC2C)C(C)C1.
What is the InChIKey of 1-[2-[2-(2,4-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,4-dimethylpiperidine?
The InChIKey is FYOLIWHOVARXHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36N2O/c1-15-5-7-19(17(3)13-15)9-11-21-12-10-20-8-6-16(2)14-18(20)4/h15-18H,5-14H2,1-4H3.
What are the key properties of 1-[2-[2-(2,4-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,4-dimethylpiperidine?
1-[2-[2-(2,4-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,4-dimethylpiperidine has a molecular weight of 296.50 g/mol, XLogP of 3.24, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[2-(2,4-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,4-dimethylpiperidine is sourced from PubChem (CID 139602227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).