C18H36N2O — CID 139602231
1-[2-[2-(2,3-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,3-dimethylpiperidine (PubChem CID 139602231) has the molecular formula C18H36N2O and a molecular weight of 296.50 g/mol. Its IUPAC name is 1-[2-[2-(2,3-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,3-dimethylpiperidine.
| Compound Name | 1-[2-[2-(2,3-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,3-dimethylpiperidine |
|---|---|
| PubChem CID | 139602231 |
| Molecular Formula | C18H36N2O |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.28 |
| IUPAC Name | 1-[2-[2-(2,3-dimethylpiperidin-1-yl)ethoxy]ethyl]-2,3-dimethylpiperidine |
| SMILES | CC1CCCN(CCOCCN2CCCC(C)C2C)C1C |
| InChI | InChI=1S/C18H36N2O/c1-15-7-5-9-19(17(15)3)11-13-21-14-12-20-10-6-8-16(2)18(20)4/h15-18H,5-14H2,1-4H3 |
| InChIKey | YJHZIZIELPMAJS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|