C15H18N2O — CID 139602599
1-hex-3-enyl-6-methyl-1,8-naphthyridin-2-one (PubChem CID 139602599) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-hex-3-enyl-6-methyl-1,8-naphthyridin-2-one.
| Compound Name | 1-hex-3-enyl-6-methyl-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 139602599 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 1-hex-3-enyl-6-methyl-1,8-naphthyridin-2-one |
| SMILES | CCC=CCCn1c(=O)ccc2cc(C)cnc21 |
| InChI | InChI=1S/C15H18N2O/c1-3-4-5-6-9-17-14(18)8-7-13-10-12(2)11-16-15(13)17/h4-5,7-8,10-11H,3,6,9H2,1-2H3 |
| InChIKey | HLYZATVSARALOQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|