C14H20O4 — CID 139603219
3-ethylpentan-3-yl 2,5-dihydroxybenzoate (PubChem CID 139603219) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 3-ethylpentan-3-yl 2,5-dihydroxybenzoate.
| Compound Name | 3-ethylpentan-3-yl 2,5-dihydroxybenzoate |
|---|---|
| PubChem CID | 139603219 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3-ethylpentan-3-yl 2,5-dihydroxybenzoate |
| SMILES | CCC(CC)(CC)OC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C14H20O4/c1-4-14(5-2,6-3)18-13(17)11-9-10(15)7-8-12(11)16/h7-9,15-16H,4-6H2,1-3H3 |
| InChIKey | JZJDZMJDKIJEBW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|