C15H25N3O5 — CID 139603950
ethyl (2S)-2-[[(2S)-2-[[(2S)-2-(2-methylprop-2-enoylamino)propanoyl]amino]propanoyl]amino]propanoate (PubChem CID 139603950) has the molecular formula C15H25N3O5 and a molecular weight of 327.38 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2S)-2-[[(2S)-2-(2-methylprop-2-enoylamino)propanoyl]amino]propanoyl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[(2S)-2-[[(2S)-2-(2-methylprop-2-enoylamino)propanoyl]amino]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 139603950 |
| Molecular Formula | C15H25N3O5 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | ethyl (2S)-2-[[(2S)-2-[[(2S)-2-(2-methylprop-2-enoylamino)propanoyl]amino]propanoyl]amino]propanoate |
| SMILES | C=C(C)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)OCC |
| InChI | InChI=1S/C15H25N3O5/c1-7-23-15(22)11(6)18-14(21)10(5)17-13(20)9(4)16-12(19)8(2)3/h9-11H,2,7H2,1,3-6H3,(H,16,19)(H,17,20)(H,18,21)/t9-,10-,11-/m0/s1 |
| InChIKey | NEUWHHOLEOTYAW-DCAQKATOSA-N |
| XLogP | -0.36 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|