About 3-(4-aminophenyl)-6,7-dioxabicyclo[3.2.1]octa-1,3,5(8)-trien-8-amine
3-(4-aminophenyl)-6,7-dioxabicyclo[3.2.1]octa-1,3,5(8)-trien-8-amine (PubChem CID 139603991) has the molecular formula C12H10N2O2
and a molecular weight of 214.22 g/mol. Its IUPAC name is 3-(4-aminophenyl)-6,7-dioxabicyclo[3.2.1]octa-1,3,5(8)-trien-8-amine.
Molecular Properties
| Compound Name | 3-(4-aminophenyl)-6,7-dioxabicyclo[3.2.1]octa-1,3,5(8)-trien-8-amine |
| PubChem CID | 139603991 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 3-(4-aminophenyl)-6,7-dioxabicyclo[3.2.1]octa-1,3,5(8)-trien-8-amine |
| SMILES | Nc1ccc(-c2cc3c(N)c(c2)OO3)cc1 |
| InChI | InChI=1S/C12H10N2O2/c13-9-3-1-7(2-4-9)8-5-10-12(14)11(6-8)16-15-10/h1-6H,13-14H2 |
| InChIKey | KKNWKEAFFGEGTF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-aminophenyl)-6,7-dioxabicyclo[3.2.1]octa-1,3,5(8)-trien-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminophenyl)-6,7-dioxabicyclo[3.2.1]octa-1,3,5(8)-trien-8-amine?
The IUPAC name of 3-(4-aminophenyl)-6,7-dioxabicyclo[3.2.1]octa-1,3,5(8)-trien-8-amine (CID 139603991) is 3-(4-aminophenyl)-6,7-dioxabicyclo[3.2.1]octa-1,3,5(8)-trien-8-amine.
What is the SMILES notation for 3-(4-aminophenyl)-6,7-dioxabicyclo[3.2.1]octa-1,3,5(8)-trien-8-amine?
The canonical SMILES for 3-(4-aminophenyl)-6,7-dioxabicyclo[3.2.1]octa-1,3,5(8)-trien-8-amine is Nc1ccc(-c2cc3c(N)c(c2)OO3)cc1.
What is the InChIKey of 3-(4-aminophenyl)-6,7-dioxabicyclo[3.2.1]octa-1,3,5(8)-trien-8-amine?
The InChIKey is KKNWKEAFFGEGTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2/c13-9-3-1-7(2-4-9)8-5-10-12(14)11(6-8)16-15-10/h1-6H,13-14H2.
What are the key properties of 3-(4-aminophenyl)-6,7-dioxabicyclo[3.2.1]octa-1,3,5(8)-trien-8-amine?
3-(4-aminophenyl)-6,7-dioxabicyclo[3.2.1]octa-1,3,5(8)-trien-8-amine has a molecular weight of 214.22 g/mol, XLogP of 2.20, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminophenyl)-6,7-dioxabicyclo[3.2.1]octa-1,3,5(8)-trien-8-amine is sourced from PubChem (CID 139603991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).