C29H48F2N2 — CID 139604045
2-[(1R,4S)-2,2-difluoro-4-(4-pentylcyclohexyl)cyclohexyl]-5-octylpyrimidine (PubChem CID 139604045) has the molecular formula C29H48F2N2 and a molecular weight of 462.71 g/mol. Its IUPAC name is 2-[(1R,4S)-2,2-difluoro-4-(4-pentylcyclohexyl)cyclohexyl]-5-octylpyrimidine.
| Compound Name | 2-[(1R,4S)-2,2-difluoro-4-(4-pentylcyclohexyl)cyclohexyl]-5-octylpyrimidine |
|---|---|
| PubChem CID | 139604045 |
| Molecular Formula | C29H48F2N2 |
| Molecular Weight | 462.71 g/mol |
| Exact Mass | 462.38 |
| IUPAC Name | 2-[(1R,4S)-2,2-difluoro-4-(4-pentylcyclohexyl)cyclohexyl]-5-octylpyrimidine |
| SMILES | CCCCCCCCc1cnc([C@H]2CC[C@H](C3CCC(CCCCC)CC3)CC2(F)F)nc1 |
| InChI | InChI=1S/C29H48F2N2/c1-3-5-7-8-9-11-13-24-21-32-28(33-22-24)27-19-18-26(20-29(27,30)31)25-16-14-23(15-17-25)12-10-6-4-2/h21-23,25-27H,3-20H2,1-2H3/t23?,25?,26-,27+/m0/s1 |
| InChIKey | NPTCOTYIVBWWRP-YMWTUSLSSA-N |
| XLogP | 9.29 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.71 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|