C24H37I — CID 139604725
(8R,9S,10S,13R,14S,17R)-17-[(2R)-5-iodopent-4-yn-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 139604725) has the molecular formula C24H37I and a molecular weight of 452.46 g/mol. Its IUPAC name is (8R,9S,10S,13R,14S,17R)-17-[(2R)-5-iodopent-4-yn-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8R,9S,10S,13R,14S,17R)-17-[(2R)-5-iodopent-4-yn-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 139604725 |
| Molecular Formula | C24H37I |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (8R,9S,10S,13R,14S,17R)-17-[(2R)-5-iodopent-4-yn-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@H](CC#CI)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H37I/c1-17(7-6-16-25)20-11-12-21-19-10-9-18-8-4-5-14-23(18,2)22(19)13-15-24(20,21)3/h17-22H,4-5,7-15H2,1-3H3/t17-,18?,19+,20-,21+,22+,23+,24-/m1/s1 |
| InChIKey | PGCBHXXNURJBDB-BRPMRXRMSA-N |
| XLogP | 7.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|