C21H17N3O2S2 — CID 1396050
(5Z)-5-[[3-(3-ethoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 1396050) has the molecular formula C21H17N3O2S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is (5Z)-5-[[3-(3-ethoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-(3-ethoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1396050 |
| Molecular Formula | C21H17N3O2S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (5Z)-5-[[3-(3-ethoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1cccc(-c2nn(-c3ccccc3)cc2/C=C2\SC(=S)NC2=O)c1 |
| InChI | InChI=1S/C21H17N3O2S2/c1-2-26-17-10-6-7-14(11-17)19-15(12-18-20(25)22-21(27)28-18)13-24(23-19)16-8-4-3-5-9-16/h3-13H,2H2,1H3,(H,22,25,27)/b18-12- |
| InChIKey | NRESSVVTNUUTKD-PDGQHHTCSA-N |
| XLogP | 4.43 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|