About 1-(2,4,4-trimethylhept-6-enoxy)propan-2-ol
1-(2,4,4-trimethylhept-6-enoxy)propan-2-ol (PubChem CID 139606101) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-(2,4,4-trimethylhept-6-enoxy)propan-2-ol.
Molecular Properties
| Compound Name | 1-(2,4,4-trimethylhept-6-enoxy)propan-2-ol |
| PubChem CID | 139606101 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 1-(2,4,4-trimethylhept-6-enoxy)propan-2-ol |
| SMILES | C=CCC(C)(C)CC(C)COCC(C)O |
| InChI | InChI=1S/C13H26O2/c1-6-7-13(4,5)8-11(2)9-15-10-12(3)14/h6,11-12,14H,1,7-10H2,2-5H3 |
| InChIKey | IDFKFXOIRCVEET-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4,4-trimethylhept-6-enoxy)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4,4-trimethylhept-6-enoxy)propan-2-ol?
The IUPAC name of 1-(2,4,4-trimethylhept-6-enoxy)propan-2-ol (CID 139606101) is 1-(2,4,4-trimethylhept-6-enoxy)propan-2-ol.
What is the SMILES notation for 1-(2,4,4-trimethylhept-6-enoxy)propan-2-ol?
The canonical SMILES for 1-(2,4,4-trimethylhept-6-enoxy)propan-2-ol is C=CCC(C)(C)CC(C)COCC(C)O.
What is the InChIKey of 1-(2,4,4-trimethylhept-6-enoxy)propan-2-ol?
The InChIKey is IDFKFXOIRCVEET-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2/c1-6-7-13(4,5)8-11(2)9-15-10-12(3)14/h6,11-12,14H,1,7-10H2,2-5H3.
What are the key properties of 1-(2,4,4-trimethylhept-6-enoxy)propan-2-ol?
1-(2,4,4-trimethylhept-6-enoxy)propan-2-ol has a molecular weight of 214.35 g/mol, XLogP of 3.01, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4,4-trimethylhept-6-enoxy)propan-2-ol is sourced from PubChem (CID 139606101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).