About sodium 3-chloro-2,4-difluorobenzenesulfinate
sodium 3-chloro-2,4-difluorobenzenesulfinate (PubChem CID 139606133) has the molecular formula C6H2ClF2NaO2S
and a molecular weight of 234.59 g/mol. Its IUPAC name is sodium 3-chloro-2,4-difluorobenzenesulfinate.
Molecular Properties
| Compound Name | sodium 3-chloro-2,4-difluorobenzenesulfinate |
| PubChem CID | 139606133 |
| Molecular Formula | C6H2ClF2NaO2S |
| Molecular Weight | 234.59 g/mol |
| Exact Mass | 233.93 |
| IUPAC Name | sodium 3-chloro-2,4-difluorobenzenesulfinate |
| SMILES | O=S([O-])c1ccc(F)c(Cl)c1F.[Na+] |
| InChI | InChI=1S/C6H3ClF2O2S.Na/c7-5-3(8)1-2-4(6(5)9)12(10)11;/h1-2H,(H,10,11);/q;+1/p-1 |
| InChIKey | VOWHTVHOZJXCHZ-UHFFFAOYSA-M |
| XLogP | -1.14 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.59 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-chloro-2,4-difluorobenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-chloro-2,4-difluorobenzenesulfinate?
The IUPAC name of sodium 3-chloro-2,4-difluorobenzenesulfinate (CID 139606133) is sodium 3-chloro-2,4-difluorobenzenesulfinate.
What is the SMILES notation for sodium 3-chloro-2,4-difluorobenzenesulfinate?
The canonical SMILES for sodium 3-chloro-2,4-difluorobenzenesulfinate is O=S([O-])c1ccc(F)c(Cl)c1F.[Na+].
What is the InChIKey of sodium 3-chloro-2,4-difluorobenzenesulfinate?
The InChIKey is VOWHTVHOZJXCHZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H3ClF2O2S.Na/c7-5-3(8)1-2-4(6(5)9)12(10)11;/h1-2H,(H,10,11);/q;+1/p-1.
What are the key properties of sodium 3-chloro-2,4-difluorobenzenesulfinate?
sodium 3-chloro-2,4-difluorobenzenesulfinate has a molecular weight of 234.59 g/mol, XLogP of -1.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-chloro-2,4-difluorobenzenesulfinate is sourced from PubChem (CID 139606133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).