C17H30O3 — CID 139606275
8-hexyl-7,9,9-trimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol (PubChem CID 139606275) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is 8-hexyl-7,9,9-trimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol.
| Compound Name | 8-hexyl-7,9,9-trimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol |
|---|---|
| PubChem CID | 139606275 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 8-hexyl-7,9,9-trimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol |
| SMILES | CCCCCCC1(O)C(C)=CC2(CC1(C)C)OCCO2 |
| InChI | InChI=1S/C17H30O3/c1-5-6-7-8-9-17(18)14(2)12-16(13-15(17,3)4)19-10-11-20-16/h12,18H,5-11,13H2,1-4H3 |
| InChIKey | UTLCBUZXCAEOCH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|