C14H23BrO2 — CID 139606283
6-bromo-8-ethyl-3,7,9,9-tetramethyl-1,4-dioxaspiro[4.5]dec-7-ene (PubChem CID 139606283) has the molecular formula C14H23BrO2 and a molecular weight of 303.24 g/mol. Its IUPAC name is 6-bromo-8-ethyl-3,7,9,9-tetramethyl-1,4-dioxaspiro[4.5]dec-7-ene.
| Compound Name | 6-bromo-8-ethyl-3,7,9,9-tetramethyl-1,4-dioxaspiro[4.5]dec-7-ene |
|---|---|
| PubChem CID | 139606283 |
| Molecular Formula | C14H23BrO2 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 6-bromo-8-ethyl-3,7,9,9-tetramethyl-1,4-dioxaspiro[4.5]dec-7-ene |
| SMILES | CCC1=C(C)C(Br)C2(CC1(C)C)OCC(C)O2 |
| InChI | InChI=1S/C14H23BrO2/c1-6-11-10(3)12(15)14(8-13(11,4)5)16-7-9(2)17-14/h9,12H,6-8H2,1-5H3 |
| InChIKey | SUFFCFWQTFBSQR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|