C16H28O3 — CID 139606292
8-butyl-3,7,9,9-tetramethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol (PubChem CID 139606292) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is 8-butyl-3,7,9,9-tetramethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol.
| Compound Name | 8-butyl-3,7,9,9-tetramethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol |
|---|---|
| PubChem CID | 139606292 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 8-butyl-3,7,9,9-tetramethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol |
| SMILES | CCCCC1(O)C(C)=CC2(CC1(C)C)OCC(C)O2 |
| InChI | InChI=1S/C16H28O3/c1-6-7-8-16(17)12(2)9-15(11-14(16,4)5)18-10-13(3)19-15/h9,13,17H,6-8,10-11H2,1-5H3 |
| InChIKey | XVQRTBZIWZCVAP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|