C20H26BrNO2 — CID 139606333
2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-N,N,3,5-tetramethylaniline (PubChem CID 139606333) has the molecular formula C20H26BrNO2 and a molecular weight of 392.34 g/mol. Its IUPAC name is 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-N,N,3,5-tetramethylaniline.
| Compound Name | 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-N,N,3,5-tetramethylaniline |
|---|---|
| PubChem CID | 139606333 |
| Molecular Formula | C20H26BrNO2 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-N,N,3,5-tetramethylaniline |
| SMILES | COc1c(C)cc(Br)c(-c2c(N(C)C)cc(C)c(OC)c2C)c1C |
| InChI | InChI=1S/C20H26BrNO2/c1-11-9-15(21)17(13(3)19(11)23-7)18-14(4)20(24-8)12(2)10-16(18)22(5)6/h9-10H,1-8H3 |
| InChIKey | IFKXPDPECAYFHJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|