About 2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylaniline
2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylaniline (PubChem CID 139606335) has the molecular formula C17H14BrF6NO
and a molecular weight of 442.20 g/mol. Its IUPAC name is 2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylaniline.
Molecular Properties
| Compound Name | 2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylaniline |
| PubChem CID | 139606335 |
| Molecular Formula | C17H14BrF6NO |
| Molecular Weight | 442.20 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | 2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylaniline |
| SMILES | COc1c(C)cc(N)c(-c2c(Br)cc(C(F)(F)F)cc2C(F)(F)F)c1C |
| InChI | InChI=1S/C17H14BrF6NO/c1-7-4-12(25)13(8(2)15(7)26-3)14-10(17(22,23)24)5-9(6-11(14)18)16(19,20)21/h4-6H,25H2,1-3H3 |
| InChIKey | SQCUIBJYPIDREA-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.20 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylaniline?
The IUPAC name of 2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylaniline (CID 139606335) is 2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylaniline.
What is the SMILES notation for 2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylaniline?
The canonical SMILES for 2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylaniline is COc1c(C)cc(N)c(-c2c(Br)cc(C(F)(F)F)cc2C(F)(F)F)c1C.
What is the InChIKey of 2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylaniline?
The InChIKey is SQCUIBJYPIDREA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrF6NO/c1-7-4-12(25)13(8(2)15(7)26-3)14-10(17(22,23)24)5-9(6-11(14)18)16(19,20)21/h4-6H,25H2,1-3H3.
What are the key properties of 2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylaniline?
2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylaniline has a molecular weight of 442.20 g/mol, XLogP of 6.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylaniline is sourced from PubChem (CID 139606335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).