C31H28F6NOP — CID 139606339
2-[2-diphenylphosphanyl-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-N,N,3,5-tetramethylaniline (PubChem CID 139606339) has the molecular formula C31H28F6NOP and a molecular weight of 575.53 g/mol. Its IUPAC name is 2-[2-diphenylphosphanyl-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-N,N,3,5-tetramethylaniline.
| Compound Name | 2-[2-diphenylphosphanyl-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-N,N,3,5-tetramethylaniline |
|---|---|
| PubChem CID | 139606339 |
| Molecular Formula | C31H28F6NOP |
| Molecular Weight | 575.53 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | 2-[2-diphenylphosphanyl-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-N,N,3,5-tetramethylaniline |
| SMILES | COc1c(C)cc(N(C)C)c(-c2c(P(c3ccccc3)c3ccccc3)cc(C(F)(F)F)cc2C(F)(F)F)c1C |
| InChI | InChI=1S/C31H28F6NOP/c1-19-16-25(38(3)4)27(20(2)29(19)39-5)28-24(31(35,36)37)17-21(30(32,33)34)18-26(28)40(22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-18H,1-5H3 |
| InChIKey | JAVUVUYUNYMQKL-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.53 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|