About 1-(6-bromo-3-methoxy-2,4-dimethylphenyl)-N,N-dimethylnaphthalen-2-amine
1-(6-bromo-3-methoxy-2,4-dimethylphenyl)-N,N-dimethylnaphthalen-2-amine (PubChem CID 139606342) has the molecular formula C21H22BrNO
and a molecular weight of 384.32 g/mol. Its IUPAC name is 1-(6-bromo-3-methoxy-2,4-dimethylphenyl)-N,N-dimethylnaphthalen-2-amine.
Molecular Properties
| Compound Name | 1-(6-bromo-3-methoxy-2,4-dimethylphenyl)-N,N-dimethylnaphthalen-2-amine |
| PubChem CID | 139606342 |
| Molecular Formula | C21H22BrNO |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 1-(6-bromo-3-methoxy-2,4-dimethylphenyl)-N,N-dimethylnaphthalen-2-amine |
| SMILES | COc1c(C)cc(Br)c(-c2c(N(C)C)ccc3ccccc23)c1C |
| InChI | InChI=1S/C21H22BrNO/c1-13-12-17(22)19(14(2)21(13)24-5)20-16-9-7-6-8-15(16)10-11-18(20)23(3)4/h6-12H,1-5H3 |
| InChIKey | YXKOMFXLZTVJIX-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(6-bromo-3-methoxy-2,4-dimethylphenyl)-N,N-dimethylnaphthalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-bromo-3-methoxy-2,4-dimethylphenyl)-N,N-dimethylnaphthalen-2-amine?
The IUPAC name of 1-(6-bromo-3-methoxy-2,4-dimethylphenyl)-N,N-dimethylnaphthalen-2-amine (CID 139606342) is 1-(6-bromo-3-methoxy-2,4-dimethylphenyl)-N,N-dimethylnaphthalen-2-amine.
What is the SMILES notation for 1-(6-bromo-3-methoxy-2,4-dimethylphenyl)-N,N-dimethylnaphthalen-2-amine?
The canonical SMILES for 1-(6-bromo-3-methoxy-2,4-dimethylphenyl)-N,N-dimethylnaphthalen-2-amine is COc1c(C)cc(Br)c(-c2c(N(C)C)ccc3ccccc23)c1C.
What is the InChIKey of 1-(6-bromo-3-methoxy-2,4-dimethylphenyl)-N,N-dimethylnaphthalen-2-amine?
The InChIKey is YXKOMFXLZTVJIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22BrNO/c1-13-12-17(22)19(14(2)21(13)24-5)20-16-9-7-6-8-15(16)10-11-18(20)23(3)4/h6-12H,1-5H3.
What are the key properties of 1-(6-bromo-3-methoxy-2,4-dimethylphenyl)-N,N-dimethylnaphthalen-2-amine?
1-(6-bromo-3-methoxy-2,4-dimethylphenyl)-N,N-dimethylnaphthalen-2-amine has a molecular weight of 384.32 g/mol, XLogP of 5.96, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-bromo-3-methoxy-2,4-dimethylphenyl)-N,N-dimethylnaphthalen-2-amine is sourced from PubChem (CID 139606342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).