C20H28FN3O9 — CID 139606388
[3-[(2R,4S,5R)-4-(ethoxymethoxy)-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-2,6-dioxopyrimidin-1-yl]methyl (2S)-1-acetylpyrrolidine-2-carboxylate (PubChem CID 139606388) has the molecular formula C20H28FN3O9 and a molecular weight of 473.45 g/mol. Its IUPAC name is [3-[(2R,4S,5R)-4-(ethoxymethoxy)-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-2,6-dioxopyrimidin-1-yl]methyl (2S)-1-acetylpyrrolidine-2-carboxylate.
| Compound Name | [3-[(2R,4S,5R)-4-(ethoxymethoxy)-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-2,6-dioxopyrimidin-1-yl]methyl (2S)-1-acetylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 139606388 |
| Molecular Formula | C20H28FN3O9 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | [3-[(2R,4S,5R)-4-(ethoxymethoxy)-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-2,6-dioxopyrimidin-1-yl]methyl (2S)-1-acetylpyrrolidine-2-carboxylate |
| SMILES | CCOCO[C@H]1C[C@H](n2cc(F)c(=O)n(COC(=O)[C@@H]3CCCN3C(C)=O)c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C20H28FN3O9/c1-3-30-11-32-15-7-17(33-16(15)9-25)23-8-13(21)18(27)24(20(23)29)10-31-19(28)14-5-4-6-22(14)12(2)26/h8,14-17,25H,3-7,9-11H2,1-2H3/t14-,15-,16+,17+/m0/s1 |
| InChIKey | WYPZUJIXIIGEDY-MWDXBVQZSA-N |
| XLogP | -0.68 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|