C20H18F8O2 — CID 139606457
1-[4-(3,5-dimethylphenoxy)-1,1,2,2,3,3,4,4-octafluorobutoxy]-3,5-dimethylbenzene (PubChem CID 139606457) has the molecular formula C20H18F8O2 and a molecular weight of 442.35 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylphenoxy)-1,1,2,2,3,3,4,4-octafluorobutoxy]-3,5-dimethylbenzene.
| Compound Name | 1-[4-(3,5-dimethylphenoxy)-1,1,2,2,3,3,4,4-octafluorobutoxy]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 139606457 |
| Molecular Formula | C20H18F8O2 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 1-[4-(3,5-dimethylphenoxy)-1,1,2,2,3,3,4,4-octafluorobutoxy]-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)Oc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C20H18F8O2/c1-11-5-12(2)8-15(7-11)29-19(25,26)17(21,22)18(23,24)20(27,28)30-16-9-13(3)6-14(4)10-16/h5-10H,1-4H3 |
| InChIKey | RJPDGUGJLOCEDG-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|