C45H64N4O — CID 139607708
2-[bis[4-(diethylamino)phenyl]methyl]-N-[2-[3-(dibutylamino)phenoxy]ethyl]-5-ethylaniline (PubChem CID 139607708) has the molecular formula C45H64N4O and a molecular weight of 677.03 g/mol. Its IUPAC name is 2-[bis[4-(diethylamino)phenyl]methyl]-N-[2-[3-(dibutylamino)phenoxy]ethyl]-5-ethylaniline.
| Compound Name | 2-[bis[4-(diethylamino)phenyl]methyl]-N-[2-[3-(dibutylamino)phenoxy]ethyl]-5-ethylaniline |
|---|---|
| PubChem CID | 139607708 |
| Molecular Formula | C45H64N4O |
| Molecular Weight | 677.03 g/mol |
| Exact Mass | 676.51 |
| IUPAC Name | 2-[bis[4-(diethylamino)phenyl]methyl]-N-[2-[3-(dibutylamino)phenoxy]ethyl]-5-ethylaniline |
| SMILES | CCCCN(CCCC)c1cccc(OCCNc2cc(CC)ccc2C(c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CC)cc2)c1 |
| InChI | InChI=1S/C45H64N4O/c1-8-15-31-49(32-16-9-2)41-18-17-19-42(35-41)50-33-30-46-44-34-36(10-3)20-29-43(44)45(37-21-25-39(26-22-37)47(11-4)12-5)38-23-27-40(28-24-38)48(13-6)14-7/h17-29,34-35,45-46H,8-16,30-33H2,1-7H3 |
| InChIKey | KPXJZRAKGWGRNZ-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 30.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.03 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|