C36H46N4O — CID 139607710
2-[bis[4-(dimethylamino)phenyl]methyl]-N-[2-[3-(diethylamino)phenoxy]ethyl]-5-methylaniline (PubChem CID 139607710) has the molecular formula C36H46N4O and a molecular weight of 550.79 g/mol. Its IUPAC name is 2-[bis[4-(dimethylamino)phenyl]methyl]-N-[2-[3-(diethylamino)phenoxy]ethyl]-5-methylaniline.
| Compound Name | 2-[bis[4-(dimethylamino)phenyl]methyl]-N-[2-[3-(diethylamino)phenoxy]ethyl]-5-methylaniline |
|---|---|
| PubChem CID | 139607710 |
| Molecular Formula | C36H46N4O |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.37 |
| IUPAC Name | 2-[bis[4-(dimethylamino)phenyl]methyl]-N-[2-[3-(diethylamino)phenoxy]ethyl]-5-methylaniline |
| SMILES | CCN(CC)c1cccc(OCCNc2cc(C)ccc2C(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C36H46N4O/c1-8-40(9-2)32-11-10-12-33(26-32)41-24-23-37-35-25-27(3)13-22-34(35)36(28-14-18-30(19-15-28)38(4)5)29-16-20-31(21-17-29)39(6)7/h10-22,25-26,36-37H,8-9,23-24H2,1-7H3 |
| InChIKey | JZDOFQASRQZBFU-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 30.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|