C41H56N4O — CID 139607711
2-[bis[4-(diethylamino)phenyl]methyl]-N-[2-[3-(diethylamino)phenoxy]ethyl]-5-ethylaniline (PubChem CID 139607711) has the molecular formula C41H56N4O and a molecular weight of 620.93 g/mol. Its IUPAC name is 2-[bis[4-(diethylamino)phenyl]methyl]-N-[2-[3-(diethylamino)phenoxy]ethyl]-5-ethylaniline.
| Compound Name | 2-[bis[4-(diethylamino)phenyl]methyl]-N-[2-[3-(diethylamino)phenoxy]ethyl]-5-ethylaniline |
|---|---|
| PubChem CID | 139607711 |
| Molecular Formula | C41H56N4O |
| Molecular Weight | 620.93 g/mol |
| Exact Mass | 620.45 |
| IUPAC Name | 2-[bis[4-(diethylamino)phenyl]methyl]-N-[2-[3-(diethylamino)phenoxy]ethyl]-5-ethylaniline |
| SMILES | CCc1ccc(C(c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CC)cc2)c(NCCOc2cccc(N(CC)CC)c2)c1 |
| InChI | InChI=1S/C41H56N4O/c1-8-32-18-27-39(40(30-32)42-28-29-46-38-17-15-16-37(31-38)45(13-6)14-7)41(33-19-23-35(24-20-33)43(9-2)10-3)34-21-25-36(26-22-34)44(11-4)12-5/h15-27,30-31,41-42H,8-14,28-29H2,1-7H3 |
| InChIKey | MSUZBVOBERBIHQ-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 30.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.93 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|