C22H24O8 — CID 139607773
(3Z)-4-[(3,4-dihydroxy-5-methoxyphenyl)methyl]-3-[(3,4,5-trimethoxyphenyl)methylidene]oxolan-2-one (PubChem CID 139607773) has the molecular formula C22H24O8 and a molecular weight of 416.43 g/mol. Its IUPAC name is (3Z)-4-[(3,4-dihydroxy-5-methoxyphenyl)methyl]-3-[(3,4,5-trimethoxyphenyl)methylidene]oxolan-2-one.
| Compound Name | (3Z)-4-[(3,4-dihydroxy-5-methoxyphenyl)methyl]-3-[(3,4,5-trimethoxyphenyl)methylidene]oxolan-2-one |
|---|---|
| PubChem CID | 139607773 |
| Molecular Formula | C22H24O8 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (3Z)-4-[(3,4-dihydroxy-5-methoxyphenyl)methyl]-3-[(3,4,5-trimethoxyphenyl)methylidene]oxolan-2-one |
| SMILES | COc1cc(CC2COC(=O)/C2=C\c2cc(OC)c(OC)c(OC)c2)cc(O)c1O |
| InChI | InChI=1S/C22H24O8/c1-26-17-8-12(7-16(23)20(17)24)5-14-11-30-22(25)15(14)6-13-9-18(27-2)21(29-4)19(10-13)28-3/h6-10,14,23-24H,5,11H2,1-4H3/b15-6- |
| InChIKey | ALIKCRHFMLTZHA-UUASQNMZSA-N |
| XLogP | 2.93 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|