C14H26F4O2 — CID 139607930
2-fluoro-12-(2,2,2-trifluoroethoxy)dodecan-1-ol (PubChem CID 139607930) has the molecular formula C14H26F4O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-fluoro-12-(2,2,2-trifluoroethoxy)dodecan-1-ol.
| Compound Name | 2-fluoro-12-(2,2,2-trifluoroethoxy)dodecan-1-ol |
|---|---|
| PubChem CID | 139607930 |
| Molecular Formula | C14H26F4O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 2-fluoro-12-(2,2,2-trifluoroethoxy)dodecan-1-ol |
| SMILES | OCC(F)CCCCCCCCCCOCC(F)(F)F |
| InChI | InChI=1S/C14H26F4O2/c15-13(11-19)9-7-5-3-1-2-4-6-8-10-20-12-14(16,17)18/h13,19H,1-12H2 |
| InChIKey | OZJHEWFVDLVXDM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|