C31H35F3N2O4 — CID 139608278
[(2S)-1,1,1-trifluorohexan-2-yl] 4-[4-(5-hexylpyrimidin-2-yl)benzoyl]oxy-2-methylbenzoate (PubChem CID 139608278) has the molecular formula C31H35F3N2O4 and a molecular weight of 556.63 g/mol. Its IUPAC name is [(2S)-1,1,1-trifluorohexan-2-yl] 4-[4-(5-hexylpyrimidin-2-yl)benzoyl]oxy-2-methylbenzoate.
| Compound Name | [(2S)-1,1,1-trifluorohexan-2-yl] 4-[4-(5-hexylpyrimidin-2-yl)benzoyl]oxy-2-methylbenzoate |
|---|---|
| PubChem CID | 139608278 |
| Molecular Formula | C31H35F3N2O4 |
| Molecular Weight | 556.63 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | [(2S)-1,1,1-trifluorohexan-2-yl] 4-[4-(5-hexylpyrimidin-2-yl)benzoyl]oxy-2-methylbenzoate |
| SMILES | CCCCCCc1cnc(-c2ccc(C(=O)Oc3ccc(C(=O)O[C@@H](CCCC)C(F)(F)F)c(C)c3)cc2)nc1 |
| InChI | InChI=1S/C31H35F3N2O4/c1-4-6-8-9-10-22-19-35-28(36-20-22)23-12-14-24(15-13-23)29(37)39-25-16-17-26(21(3)18-25)30(38)40-27(11-7-5-2)31(32,33)34/h12-20,27H,4-11H2,1-3H3/t27-/m0/s1 |
| InChIKey | VELGCFOLEOBWDL-MHZLTWQESA-N |
| XLogP | 8.07 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.63 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|