C38H64N10S4 — CID 139608335
6-(dicyclohexylamino)-4-[[6-[[2-(dicyclohexylamino)-6-sulfanylidene-1H-1,3,5-triazin-4-yl]sulfanylmethylamino]hexylamino]methylsulfanyl]-1H-1,3,5-triazine-2-thione (PubChem CID 139608335) has the molecular formula C38H64N10S4 and a molecular weight of 789.27 g/mol. Its IUPAC name is 6-(dicyclohexylamino)-4-[[6-[[2-(dicyclohexylamino)-6-sulfanylidene-1H-1,3,5-triazin-4-yl]sulfanylmethylamino]hexylamino]methylsulfanyl]-1H-1,3,5-triazine-2-thione.
| Compound Name | 6-(dicyclohexylamino)-4-[[6-[[2-(dicyclohexylamino)-6-sulfanylidene-1H-1,3,5-triazin-4-yl]sulfanylmethylamino]hexylamino]methylsulfanyl]-1H-1,3,5-triazine-2-thione |
|---|---|
| PubChem CID | 139608335 |
| Molecular Formula | C38H64N10S4 |
| Molecular Weight | 789.27 g/mol |
| Exact Mass | 788.42 |
| IUPAC Name | 6-(dicyclohexylamino)-4-[[6-[[2-(dicyclohexylamino)-6-sulfanylidene-1H-1,3,5-triazin-4-yl]sulfanylmethylamino]hexylamino]methylsulfanyl]-1H-1,3,5-triazine-2-thione |
| SMILES | S=c1nc(SCNCCCCCCNCSc2nc(N(C3CCCCC3)C3CCCCC3)[nH]c(=S)n2)nc(N(C2CCCCC2)C2CCCCC2)[nH]1 |
| InChI | InChI=1S/C38H64N10S4/c49-35-41-33(47(29-17-7-3-8-18-29)30-19-9-4-10-20-30)43-37(45-35)51-27-39-25-15-1-2-16-26-40-28-52-38-44-34(42-36(50)46-38)48(31-21-11-5-12-22-31)32-23-13-6-14-24-32/h29-32,39-40H,1-28H2,(H,41,43,45,49)(H,42,44,46,50) |
| InChIKey | NRNZLOISGBTTAB-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.27 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|