C19H26O2 — CID 139609239
(3aS,3bR,9aR,9bS,11aS)-5,9a,11a-trimethyl-3a,3b,4,8,9,9b,10,11-octahydro-3H-naphtho[2,1-e][2]benzofuran-1-one (PubChem CID 139609239) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is (3aS,3bR,9aR,9bS,11aS)-5,9a,11a-trimethyl-3a,3b,4,8,9,9b,10,11-octahydro-3H-naphtho[2,1-e][2]benzofuran-1-one.
| Compound Name | (3aS,3bR,9aR,9bS,11aS)-5,9a,11a-trimethyl-3a,3b,4,8,9,9b,10,11-octahydro-3H-naphtho[2,1-e][2]benzofuran-1-one |
|---|---|
| PubChem CID | 139609239 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (3aS,3bR,9aR,9bS,11aS)-5,9a,11a-trimethyl-3a,3b,4,8,9,9b,10,11-octahydro-3H-naphtho[2,1-e][2]benzofuran-1-one |
| SMILES | CC1=C2C=CCC[C@]2(C)[C@H]2CC[C@]3(C)C(=O)OC[C@H]3[C@@H]2C1 |
| InChI | InChI=1S/C19H26O2/c1-12-10-13-15(18(2)8-5-4-6-14(12)18)7-9-19(3)16(13)11-21-17(19)20/h4,6,13,15-16H,5,7-11H2,1-3H3/t13-,15+,16+,18+,19+/m1/s1 |
| InChIKey | MRSADTKBXIDPLQ-DAYRTQLQSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |